About 2-aminoethenyl hydrogen sulfite
2-aminoethenyl hydrogen sulfite (PubChem CID 174363043) has the molecular formula C2H5NO3S
and a molecular weight of 123.13 g/mol. Its IUPAC name is 2-aminoethenyl hydrogen sulfite.
Molecular Properties
| Compound Name | 2-aminoethenyl hydrogen sulfite |
| PubChem CID | 174363043 |
| Molecular Formula | C2H5NO3S |
| Molecular Weight | 123.13 g/mol |
| Exact Mass | 123.00 |
| IUPAC Name | 2-aminoethenyl hydrogen sulfite |
| SMILES | NC=COS(=O)O |
| InChI | InChI=1S/C2H5NO3S/c3-1-2-6-7(4)5/h1-2H,3H2,(H,4,5) |
| InChIKey | ZMISGDCDMCLVIP-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.13 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethenyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethenyl hydrogen sulfite?
The IUPAC name of 2-aminoethenyl hydrogen sulfite (CID 174363043) is 2-aminoethenyl hydrogen sulfite.
What is the SMILES notation for 2-aminoethenyl hydrogen sulfite?
The canonical SMILES for 2-aminoethenyl hydrogen sulfite is NC=COS(=O)O.
What is the InChIKey of 2-aminoethenyl hydrogen sulfite?
The InChIKey is ZMISGDCDMCLVIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO3S/c3-1-2-6-7(4)5/h1-2H,3H2,(H,4,5).
What are the key properties of 2-aminoethenyl hydrogen sulfite?
2-aminoethenyl hydrogen sulfite has a molecular weight of 123.13 g/mol, XLogP of -0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethenyl hydrogen sulfite is sourced from PubChem (CID 174363043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).