C32H46N2 — CID 174363673
6-[(3R,7Z,8Z)-4-[(E)-1-ethenylprop-1-enyl]-7-ethylidenedeca-1,8-dien-3-yl]-4-[(1E,4R)-4-ethyl-3-prop-2-enylhexa-1,5-dienyl]-1,4-dihydropyrimidine (PubChem CID 174363673) has the molecular formula C32H46N2 and a molecular weight of 458.73 g/mol. Its IUPAC name is 6-[(3R,7Z,8Z)-4-[(E)-1-ethenylprop-1-enyl]-7-ethylidenedeca-1,8-dien-3-yl]-4-[(1E,4R)-4-ethyl-3-prop-2-enylhexa-1,5-dienyl]-1,4-dihydropyrimidine.
| Compound Name | 6-[(3R,7Z,8Z)-4-[(E)-1-ethenylprop-1-enyl]-7-ethylidenedeca-1,8-dien-3-yl]-4-[(1E,4R)-4-ethyl-3-prop-2-enylhexa-1,5-dienyl]-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 174363673 |
| Molecular Formula | C32H46N2 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.37 |
| IUPAC Name | 6-[(3R,7Z,8Z)-4-[(E)-1-ethenylprop-1-enyl]-7-ethylidenedeca-1,8-dien-3-yl]-4-[(1E,4R)-4-ethyl-3-prop-2-enylhexa-1,5-dienyl]-1,4-dihydropyrimidine |
| SMILES | C=CCC(/C=C/C1C=C([C@H](C=C)C(CCC(/C=C\C)=C/C)/C(C=C)=C/C)NC=N1)[C@@H](C=C)CC |
| InChI | InChI=1S/C32H46N2/c1-9-17-25(11-3)19-22-31(27(14-6)15-7)30(16-8)32-23-29(33-24-34-32)21-20-28(18-10-2)26(12-4)13-5/h9-12,14-17,20-21,23-24,26,28-31H,2,4,6,8,13,18-19,22H2,1,3,5,7H3,(H,33,34)/b17-9-,21-20+,25-11+,27-15+/t26-,28?,29?,30+,31?/m0/s1 |
| InChIKey | IKAASRHSHBHNQF-DIZYHVLLSA-N |
| XLogP | 8.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|