C15H26N2 — CID 174363724
(6S)-5-ethyl-6-methyl-2-[(2E,4R)-4-methylhepta-2,6-dienyl]-1,4,5,6-tetrahydropyrimidine (PubChem CID 174363724) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (6S)-5-ethyl-6-methyl-2-[(2E,4R)-4-methylhepta-2,6-dienyl]-1,4,5,6-tetrahydropyrimidine.
| Compound Name | (6S)-5-ethyl-6-methyl-2-[(2E,4R)-4-methylhepta-2,6-dienyl]-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 174363724 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (6S)-5-ethyl-6-methyl-2-[(2E,4R)-4-methylhepta-2,6-dienyl]-1,4,5,6-tetrahydropyrimidine |
| SMILES | C=CC[C@@H](C)/C=C/CC1=NCC(CC)[C@H](C)N1 |
| InChI | InChI=1S/C15H26N2/c1-5-8-12(3)9-7-10-15-16-11-14(6-2)13(4)17-15/h5,7,9,12-14H,1,6,8,10-11H2,2-4H3,(H,16,17)/b9-7+/t12-,13+,14?/m1/s1 |
| InChIKey | HYCWKHKVHQCARH-AAANBBOSSA-N |
| XLogP | 3.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|