C44H87NO6 — CID 174363755
nonyl 8-[6-heptadecan-9-yloxycarbonyloxyhexyl(3-hydroxypropyl)amino]octanoate (PubChem CID 174363755) has the molecular formula C44H87NO6 and a molecular weight of 726.18 g/mol. Its IUPAC name is nonyl 8-[6-heptadecan-9-yloxycarbonyloxyhexyl(3-hydroxypropyl)amino]octanoate.
| Compound Name | nonyl 8-[6-heptadecan-9-yloxycarbonyloxyhexyl(3-hydroxypropyl)amino]octanoate |
|---|---|
| PubChem CID | 174363755 |
| Molecular Formula | C44H87NO6 |
| Molecular Weight | 726.18 g/mol |
| Exact Mass | 725.65 |
| IUPAC Name | nonyl 8-[6-heptadecan-9-yloxycarbonyloxyhexyl(3-hydroxypropyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCO)CCCCCCOC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C44H87NO6/c1-4-7-10-13-16-23-30-40-49-43(47)35-27-20-17-21-28-36-45(38-32-39-46)37-29-22-24-31-41-50-44(48)51-42(33-25-18-14-11-8-5-2)34-26-19-15-12-9-6-3/h42,46H,4-41H2,1-3H3 |
| InChIKey | MKFXBRIVSQSANG-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.18 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|