About (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine
(3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine (PubChem CID 174363933) has the molecular formula C15H23N3O
and a molecular weight of 261.37 g/mol. Its IUPAC name is (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine.
Molecular Properties
| Compound Name | (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine |
| PubChem CID | 174363933 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine |
| SMILES | Cc1cnc2c(c1)[C@H](N)C1(CCN(C(C)C)CC1)O2 |
| InChI | InChI=1S/C15H23N3O/c1-10(2)18-6-4-15(5-7-18)13(16)12-8-11(3)9-17-14(12)19-15/h8-10,13H,4-7,16H2,1-3H3/t13-/m0/s1 |
| InChIKey | NSBWCHSMISXIGF-ZDUSSCGKSA-N |
| XLogP | 2.03 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine?
The IUPAC name of (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine (CID 174363933) is (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine.
What is the SMILES notation for (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine?
The canonical SMILES for (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine is Cc1cnc2c(c1)[C@H](N)C1(CCN(C(C)C)CC1)O2.
What is the InChIKey of (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine?
The InChIKey is NSBWCHSMISXIGF-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H23N3O/c1-10(2)18-6-4-15(5-7-18)13(16)12-8-11(3)9-17-14(12)19-15/h8-10,13H,4-7,16H2,1-3H3/t13-/m0/s1.
What are the key properties of (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine?
(3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine has a molecular weight of 261.37 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-methyl-1'-propan-2-ylspiro[3H-furo[2,3-b]pyridine-2,4'-piperidine]-3-amine is sourced from PubChem (CID 174363933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).