C17H28O6 — CID 174364
((2,2-Dimethylpropane-1,3-diyl)bis(oxy)propane-3,1-diyl) diprop-2-enoate (PubChem CID 174364) has the molecular formula C17H28O6 and a molecular weight of 328.40 g/mol. Its IUPAC name is 3-[2,2-dimethyl-3-(3-prop-2-enoyloxypropoxy)propoxy]propyl prop-2-enoate.
| Compound Name | ((2,2-Dimethylpropane-1,3-diyl)bis(oxy)propane-3,1-diyl) diprop-2-enoate |
|---|---|
| PubChem CID | 174364 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 3-[2,2-dimethyl-3-(3-prop-2-enoyloxypropoxy)propoxy]propyl prop-2-enoate |
| SMILES | CC(C)(COCCCOC(=O)C=C)COCCCOC(=O)C=C |
| InChI | InChI=1S/C17H28O6/c1-5-15(18)22-11-7-9-20-13-17(3,4)14-21-10-8-12-23-16(19)6-2/h5-6H,1-2,7-14H2,3-4H3 |
| InChIKey | NQGDHQASSFDDLD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 71.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | 341 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|