About 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene
2-methylphenol;3-prop-2-enylsulfanylprop-1-ene (PubChem CID 174364592) has the molecular formula C13H18OS
and a molecular weight of 222.35 g/mol. Its IUPAC name is 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene.
Molecular Properties
| Compound Name | 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene |
| PubChem CID | 174364592 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene |
| SMILES | C=CCSCC=C.Cc1ccccc1O |
| InChI | InChI=1S/C7H8O.C6H10S/c1-6-4-2-3-5-7(6)8;1-3-5-7-6-4-2/h2-5,8H,1H3;3-4H,1-2,5-6H2 |
| InChIKey | SHTGZCDAUCEYMV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene?
The IUPAC name of 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene (CID 174364592) is 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene.
What is the SMILES notation for 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene?
The canonical SMILES for 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene is C=CCSCC=C.Cc1ccccc1O.
What is the InChIKey of 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene?
The InChIKey is SHTGZCDAUCEYMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H10S/c1-6-4-2-3-5-7(6)8;1-3-5-7-6-4-2/h2-5,8H,1H3;3-4H,1-2,5-6H2.
What are the key properties of 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene?
2-methylphenol;3-prop-2-enylsulfanylprop-1-ene has a molecular weight of 222.35 g/mol, XLogP of 3.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylphenol;3-prop-2-enylsulfanylprop-1-ene is sourced from PubChem (CID 174364592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).