About 2-bromo-3-oxooct-6-enoic acid
2-bromo-3-oxooct-6-enoic acid (PubChem CID 174364933) has the molecular formula C8H11BrO3
and a molecular weight of 235.08 g/mol. Its IUPAC name is 2-bromo-3-oxooct-6-enoic acid.
Molecular Properties
| Compound Name | 2-bromo-3-oxooct-6-enoic acid |
| PubChem CID | 174364933 |
| Molecular Formula | C8H11BrO3 |
| Molecular Weight | 235.08 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 2-bromo-3-oxooct-6-enoic acid |
| SMILES | CC=CCCC(=O)C(Br)C(=O)O |
| InChI | InChI=1S/C8H11BrO3/c1-2-3-4-5-6(10)7(9)8(11)12/h2-3,7H,4-5H2,1H3,(H,11,12) |
| InChIKey | QZWUGMLBJRMIBE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.08 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-oxooct-6-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-oxooct-6-enoic acid?
The IUPAC name of 2-bromo-3-oxooct-6-enoic acid (CID 174364933) is 2-bromo-3-oxooct-6-enoic acid.
What is the SMILES notation for 2-bromo-3-oxooct-6-enoic acid?
The canonical SMILES for 2-bromo-3-oxooct-6-enoic acid is CC=CCCC(=O)C(Br)C(=O)O.
What is the InChIKey of 2-bromo-3-oxooct-6-enoic acid?
The InChIKey is QZWUGMLBJRMIBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrO3/c1-2-3-4-5-6(10)7(9)8(11)12/h2-3,7H,4-5H2,1H3,(H,11,12).
What are the key properties of 2-bromo-3-oxooct-6-enoic acid?
2-bromo-3-oxooct-6-enoic acid has a molecular weight of 235.08 g/mol, XLogP of 1.76, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-oxooct-6-enoic acid is sourced from PubChem (CID 174364933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).