C27H34ClN5O — CID 174365145
4-[2-[1,4-bis(ethylamino)cyclohexa-2,4-dien-1-yl]-5-(2-chlorophenyl)-1,3-oxazol-4-yl]-1-N,4-N-dimethylcyclohexa-1,5-diene-1,4-diamine (PubChem CID 174365145) has the molecular formula C27H34ClN5O and a molecular weight of 480.06 g/mol. Its IUPAC name is 4-[2-[1,4-bis(ethylamino)cyclohexa-2,4-dien-1-yl]-5-(2-chlorophenyl)-1,3-oxazol-4-yl]-1-N,4-N-dimethylcyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 4-[2-[1,4-bis(ethylamino)cyclohexa-2,4-dien-1-yl]-5-(2-chlorophenyl)-1,3-oxazol-4-yl]-1-N,4-N-dimethylcyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 174365145 |
| Molecular Formula | C27H34ClN5O |
| Molecular Weight | 480.06 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 4-[2-[1,4-bis(ethylamino)cyclohexa-2,4-dien-1-yl]-5-(2-chlorophenyl)-1,3-oxazol-4-yl]-1-N,4-N-dimethylcyclohexa-1,5-diene-1,4-diamine |
| SMILES | CCNC1=CCC(NCC)(c2nc(C3(NC)C=CC(NC)=CC3)c(-c3ccccc3Cl)o2)C=C1 |
| InChI | InChI=1S/C27H34ClN5O/c1-5-31-20-13-17-27(18-14-20,32-6-2)25-33-24(23(34-25)21-9-7-8-10-22(21)28)26(30-4)15-11-19(29-3)12-16-26/h7-15,17,29-32H,5-6,16,18H2,1-4H3 |
| InChIKey | JEOMDARMPWKZNH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.06 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |