About 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine
3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine (PubChem CID 174365536) has the molecular formula C11H15NS
and a molecular weight of 193.31 g/mol. Its IUPAC name is 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 174365536 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine |
| SMILES | CC1=CCC(C2C=C(N)C=CC2)S1 |
| InChI | InChI=1S/C11H15NS/c1-8-5-6-11(13-8)9-3-2-4-10(12)7-9/h2,4-5,7,9,11H,3,6,12H2,1H3 |
| InChIKey | SYJUFLHMDJVWIP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine?
The IUPAC name of 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine (CID 174365536) is 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine is CC1=CCC(C2C=C(N)C=CC2)S1.
What is the InChIKey of 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine?
The InChIKey is SYJUFLHMDJVWIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NS/c1-8-5-6-11(13-8)9-3-2-4-10(12)7-9/h2,4-5,7,9,11H,3,6,12H2,1H3.
What are the key properties of 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine?
3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine has a molecular weight of 193.31 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-2,3-dihydrothiophen-2-yl)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 174365536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).