About CID 174365731
CID 174365731 (PubChem CID 174365731) has the molecular formula C8H15BO7
and a molecular weight of 234.01 g/mol.
Molecular Properties
| Compound Name | CID 174365731 |
| PubChem CID | 174365731 |
| Molecular Formula | C8H15BO7 |
| Molecular Weight | 234.01 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | — |
| SMILES | [B]C1(C)CC(O)(O)C(O)(O)C(C)(O)C1(O)O |
| InChI | InChI=1S/C8H15BO7/c1-4(9)3-6(11,12)8(15,16)5(2,10)7(4,13)14/h10-16H,3H2,1-2H3 |
| InChIKey | UMORCCURGCCFOM-UHFFFAOYSA-N |
| XLogP | -3.47 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.01 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 174365731 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174365731?
The IUPAC name of CID 174365731 (CID 174365731) is not available.
What is the SMILES notation for CID 174365731?
The canonical SMILES for CID 174365731 is [B]C1(C)CC(O)(O)C(O)(O)C(C)(O)C1(O)O.
What is the InChIKey of CID 174365731?
The InChIKey is UMORCCURGCCFOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BO7/c1-4(9)3-6(11,12)8(15,16)5(2,10)7(4,13)14/h10-16H,3H2,1-2H3.
What are the key properties of CID 174365731?
CID 174365731 has a molecular weight of 234.01 g/mol, XLogP of -3.47, 0 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174365731 is sourced from PubChem (CID 174365731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).