About (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine
(2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine (PubChem CID 174365742) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine |
| PubChem CID | 174365742 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine |
| SMILES | C=NC(N)/C(=C/C=C/C)C(C)C |
| InChI | InChI=1S/C10H18N2/c1-5-6-7-9(8(2)3)10(11)12-4/h5-8,10H,4,11H2,1-3H3/b6-5+,9-7+ |
| InChIKey | OMPFZPDGPXELBB-SBIWHPGTSA-N |
| XLogP | 2.13 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine?
The IUPAC name of (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine (CID 174365742) is (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine.
What is the SMILES notation for (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine?
The canonical SMILES for (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine is C=NC(N)/C(=C/C=C/C)C(C)C.
What is the InChIKey of (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine?
The InChIKey is OMPFZPDGPXELBB-SBIWHPGTSA-N. The full InChI is InChI=1S/C10H18N2/c1-5-6-7-9(8(2)3)10(11)12-4/h5-8,10H,4,11H2,1-3H3/b6-5+,9-7+.
What are the key properties of (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine?
(2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine has a molecular weight of 166.27 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-1-(methylideneamino)-2-propan-2-ylhexa-2,4-dien-1-amine is sourced from PubChem (CID 174365742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).