C19H23N3O4 — CID 174365926
4-phenyl-4-[2,4,5-tris(methylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]butanoic acid (PubChem CID 174365926) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-phenyl-4-[2,4,5-tris(methylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]butanoic acid.
| Compound Name | 4-phenyl-4-[2,4,5-tris(methylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]butanoic acid |
|---|---|
| PubChem CID | 174365926 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-phenyl-4-[2,4,5-tris(methylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]butanoic acid |
| SMILES | CNC1=C(NC)C(=O)C(C(CCC(=O)O)c2ccccc2)=C(NC)C1=O |
| InChI | InChI=1S/C19H23N3O4/c1-20-15-14(18(25)16(21-2)17(22-3)19(15)26)12(9-10-13(23)24)11-7-5-4-6-8-11/h4-8,12,20-22H,9-10H2,1-3H3,(H,23,24) |
| InChIKey | YEUUMHKHEXJUOX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|