C8H9N3O — CID 174366236
6-ethyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 174366236) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 6-ethyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 6-ethyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 174366236 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 6-ethyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | CCc1cc2c(=O)[nH]cnn2c1 |
| InChI | InChI=1S/C8H9N3O/c1-2-6-3-7-8(12)9-5-10-11(7)4-6/h3-5H,2H2,1H3,(H,9,10,12) |
| InChIKey | CXYQWSNTFKWJBQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |