C10H9FN2O2 — CID 174366506
2-(6-fluoro-1,2,3,4-tetrahydroquinazolin-4-yl)-2-oxoacetaldehyde (PubChem CID 174366506) has the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. Its IUPAC name is 2-(6-fluoro-1,2,3,4-tetrahydroquinazolin-4-yl)-2-oxoacetaldehyde.
| Compound Name | 2-(6-fluoro-1,2,3,4-tetrahydroquinazolin-4-yl)-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174366506 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 2-(6-fluoro-1,2,3,4-tetrahydroquinazolin-4-yl)-2-oxoacetaldehyde |
| SMILES | O=CC(=O)C1NCNc2ccc(F)cc21 |
| InChI | InChI=1S/C10H9FN2O2/c11-6-1-2-8-7(3-6)10(9(15)4-14)13-5-12-8/h1-4,10,12-13H,5H2 |
| InChIKey | CQEWQALUYUQQDJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|