C17H21ClN3+ — CID 174366661
4-chloro-3-(cyclohexa-1,5-dien-1-ylmethyl)-6-[(2Z)-2-ethenylpenta-2,4-dienyl]-1,4-dihydro-1,3,5-triazin-3-ium (PubChem CID 174366661) has the molecular formula C17H21ClN3+ and a molecular weight of 302.83 g/mol. Its IUPAC name is 4-chloro-3-(cyclohexa-1,5-dien-1-ylmethyl)-6-[(2Z)-2-ethenylpenta-2,4-dienyl]-1,4-dihydro-1,3,5-triazin-3-ium.
| Compound Name | 4-chloro-3-(cyclohexa-1,5-dien-1-ylmethyl)-6-[(2Z)-2-ethenylpenta-2,4-dienyl]-1,4-dihydro-1,3,5-triazin-3-ium |
|---|---|
| PubChem CID | 174366661 |
| Molecular Formula | C17H21ClN3+ |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-chloro-3-(cyclohexa-1,5-dien-1-ylmethyl)-6-[(2Z)-2-ethenylpenta-2,4-dienyl]-1,4-dihydro-1,3,5-triazin-3-ium |
| SMILES | C=C/C=C(\C=C)CC1=NC(Cl)[N+](CC2=CCCC=C2)=CN1 |
| InChI | InChI=1S/C17H20ClN3/c1-3-8-14(4-2)11-16-19-13-21(17(18)20-16)12-15-9-6-5-7-10-15/h3-4,6,8-10,13,17H,1-2,5,7,11-12H2/p+1/b14-8+ |
| InChIKey | KSJZIWPTHHEJFF-RIYZIHGNSA-O |
| XLogP | 3.52 |
| TPSA | 27.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|