About 3-phenylbenzene-1,2-diol;sulfurous acid
3-phenylbenzene-1,2-diol;sulfurous acid (PubChem CID 174366785) has the molecular formula C12H12O5S
and a molecular weight of 268.29 g/mol. Its IUPAC name is 3-phenylbenzene-1,2-diol;sulfurous acid.
Molecular Properties
| Compound Name | 3-phenylbenzene-1,2-diol;sulfurous acid |
| PubChem CID | 174366785 |
| Molecular Formula | C12H12O5S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 3-phenylbenzene-1,2-diol;sulfurous acid |
| SMILES | O=S(O)O.Oc1cccc(-c2ccccc2)c1O |
| InChI | InChI=1S/C12H10O2.H2O3S/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9;1-4(2)3/h1-8,13-14H;(H2,1,2,3) |
| InChIKey | REFIFJIURJJGPK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylbenzene-1,2-diol;sulfurous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylbenzene-1,2-diol;sulfurous acid?
The IUPAC name of 3-phenylbenzene-1,2-diol;sulfurous acid (CID 174366785) is 3-phenylbenzene-1,2-diol;sulfurous acid.
What is the SMILES notation for 3-phenylbenzene-1,2-diol;sulfurous acid?
The canonical SMILES for 3-phenylbenzene-1,2-diol;sulfurous acid is O=S(O)O.Oc1cccc(-c2ccccc2)c1O.
What is the InChIKey of 3-phenylbenzene-1,2-diol;sulfurous acid?
The InChIKey is REFIFJIURJJGPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.H2O3S/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9;1-4(2)3/h1-8,13-14H;(H2,1,2,3).
What are the key properties of 3-phenylbenzene-1,2-diol;sulfurous acid?
3-phenylbenzene-1,2-diol;sulfurous acid has a molecular weight of 268.29 g/mol, XLogP of 2.45, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylbenzene-1,2-diol;sulfurous acid is sourced from PubChem (CID 174366785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).