C33H29NO5 — CID 174367329
(2S)-2-amino-3-[2-(5,6,7,8-tetrahydrochrysen-1-yl)naphthalen-1-yl]oxypentanedioic acid (PubChem CID 174367329) has the molecular formula C33H29NO5 and a molecular weight of 519.60 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-(5,6,7,8-tetrahydrochrysen-1-yl)naphthalen-1-yl]oxypentanedioic acid.
| Compound Name | (2S)-2-amino-3-[2-(5,6,7,8-tetrahydrochrysen-1-yl)naphthalen-1-yl]oxypentanedioic acid |
|---|---|
| PubChem CID | 174367329 |
| Molecular Formula | C33H29NO5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | (2S)-2-amino-3-[2-(5,6,7,8-tetrahydrochrysen-1-yl)naphthalen-1-yl]oxypentanedioic acid |
| SMILES | N[C@H](C(=O)O)C(CC(=O)O)Oc1c(-c2cccc3c4c(ccc23)C2=C(CCC=C2)CC4)ccc2ccccc12 |
| InChI | InChI=1S/C33H29NO5/c34-31(33(37)38)29(18-30(35)36)39-32-22-9-4-2-7-20(22)13-15-28(32)24-11-5-10-23-26-14-12-19-6-1-3-8-21(19)25(26)16-17-27(23)24/h2-5,7-11,13,15-17,29,31H,1,6,12,14,18,34H2,(H,35,36)(H,37,38)/t29?,31-/m0/s1 |
| InChIKey | AZXMNDCBFKWKPG-RDFOUATCSA-N |
| XLogP | 6.34 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |