C25H38F2N6O3 — CID 174367420
(2S)-N-[1-(diaminomethylideneamino)-6,6-difluoro-5-oxononan-4-yl]-N-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 174367420) has the molecular formula C25H38F2N6O3 and a molecular weight of 508.61 g/mol. Its IUPAC name is (2S)-N-[1-(diaminomethylideneamino)-6,6-difluoro-5-oxononan-4-yl]-N-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[1-(diaminomethylideneamino)-6,6-difluoro-5-oxononan-4-yl]-N-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 174367420 |
| Molecular Formula | C25H38F2N6O3 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | (2S)-N-[1-(diaminomethylideneamino)-6,6-difluoro-5-oxononan-4-yl]-N-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC(F)(F)C(=O)C(CCCN=C(N)N)N(C(=O)[C@@H]1CCCN1)C(=O)[C@@H](Cc1ccccc1)NC |
| InChI | InChI=1S/C25H38F2N6O3/c1-3-13-25(26,27)21(34)20(12-8-15-32-24(28)29)33(22(35)18-11-7-14-31-18)23(36)19(30-2)16-17-9-5-4-6-10-17/h4-6,9-10,18-20,30-31H,3,7-8,11-16H2,1-2H3,(H4,28,29,32)/t18-,19+,20?/m0/s1 |
| InChIKey | KHHCQWOPDJLSLX-ABZYKWASSA-N |
| XLogP | 1.35 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|