About pyran-4,4-diol
pyran-4,4-diol (PubChem CID 174367615) has the molecular formula C5H6O3
and a molecular weight of 114.10 g/mol. Its IUPAC name is pyran-4,4-diol.
Molecular Properties
| Compound Name | pyran-4,4-diol |
| PubChem CID | 174367615 |
| Molecular Formula | C5H6O3 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | pyran-4,4-diol |
| SMILES | OC1(O)C=COC=C1 |
| InChI | InChI=1S/C5H6O3/c6-5(7)1-3-8-4-2-5/h1-4,6-7H |
| InChIKey | NPEUOPROLUBMFT-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze pyran-4,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyran-4,4-diol?
The IUPAC name of pyran-4,4-diol (CID 174367615) is pyran-4,4-diol.
What is the SMILES notation for pyran-4,4-diol?
The canonical SMILES for pyran-4,4-diol is OC1(O)C=COC=C1.
What is the InChIKey of pyran-4,4-diol?
The InChIKey is NPEUOPROLUBMFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3/c6-5(7)1-3-8-4-2-5/h1-4,6-7H.
What are the key properties of pyran-4,4-diol?
pyran-4,4-diol has a molecular weight of 114.10 g/mol, XLogP of -0.28, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyran-4,4-diol is sourced from PubChem (CID 174367615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).