C18H23ClN6O — CID 174367645
2-chloro-6-[(1Z)-1,4,4-triamino-3-(1-piperidin-4-ylpyrazol-4-yl)buta-1,3-dienyl]phenol (PubChem CID 174367645) has the molecular formula C18H23ClN6O and a molecular weight of 374.88 g/mol. Its IUPAC name is 2-chloro-6-[(1Z)-1,4,4-triamino-3-(1-piperidin-4-ylpyrazol-4-yl)buta-1,3-dienyl]phenol.
| Compound Name | 2-chloro-6-[(1Z)-1,4,4-triamino-3-(1-piperidin-4-ylpyrazol-4-yl)buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 174367645 |
| Molecular Formula | C18H23ClN6O |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-chloro-6-[(1Z)-1,4,4-triamino-3-(1-piperidin-4-ylpyrazol-4-yl)buta-1,3-dienyl]phenol |
| SMILES | NC(N)=C(/C=C(\N)c1cccc(Cl)c1O)c1cnn(C2CCNCC2)c1 |
| InChI | InChI=1S/C18H23ClN6O/c19-15-3-1-2-13(17(15)26)16(20)8-14(18(21)22)11-9-24-25(10-11)12-4-6-23-7-5-12/h1-3,8-10,12,23,26H,4-7,20-22H2/b16-8- |
| InChIKey | JAOIVMZPKDDKBH-PXNMLYILSA-N |
| XLogP | 1.75 |
| TPSA | 128.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|