About [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone
[4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone (PubChem CID 174368172) has the molecular formula C18H32F3N3O
and a molecular weight of 363.47 g/mol. Its IUPAC name is [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone |
| PubChem CID | 174368172 |
| Molecular Formula | C18H32F3N3O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone |
| SMILES | CCN(CC1CCN(C(=O)N2CCCCC2)CC1)C(C)CC(F)(F)F |
| InChI | InChI=1S/C18H32F3N3O/c1-3-22(15(2)13-18(19,20)21)14-16-7-11-24(12-8-16)17(25)23-9-5-4-6-10-23/h15-16H,3-14H2,1-2H3 |
| InChIKey | YIVAKGABYKXKMQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone?
The IUPAC name of [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone (CID 174368172) is [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone.
What is the SMILES notation for [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone?
The canonical SMILES for [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone is CCN(CC1CCN(C(=O)N2CCCCC2)CC1)C(C)CC(F)(F)F.
What is the InChIKey of [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone?
The InChIKey is YIVAKGABYKXKMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32F3N3O/c1-3-22(15(2)13-18(19,20)21)14-16-7-11-24(12-8-16)17(25)23-9-5-4-6-10-23/h15-16H,3-14H2,1-2H3.
What are the key properties of [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone?
[4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone has a molecular weight of 363.47 g/mol, XLogP of 3.97, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[ethyl(4,4,4-trifluorobutan-2-yl)amino]methyl]piperidin-1-yl]-piperidin-1-ylmethanone is sourced from PubChem (CID 174368172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).