About hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid
hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid (PubChem CID 174369746) has the molecular formula C19H16HfO4
and a molecular weight of 486.82 g/mol. Its IUPAC name is hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid.
Molecular Properties
| Compound Name | hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid |
| PubChem CID | 174369746 |
| Molecular Formula | C19H16HfO4 |
| Molecular Weight | 486.82 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid |
| SMILES | CC1=Cc2ccccc2C1OC(=O)c1cccc(C(=O)O)c1C.[Hf] |
| InChI | InChI=1S/C19H16O4.Hf/c1-11-10-13-6-3-4-7-16(13)17(11)23-19(22)15-9-5-8-14(12(15)2)18(20)21;/h3-10,17H,1-2H3,(H,20,21); |
| InChIKey | ZFJHPUCCCPXKDT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid?
The IUPAC name of hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid (CID 174369746) is hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid.
What is the SMILES notation for hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid?
The canonical SMILES for hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid is CC1=Cc2ccccc2C1OC(=O)c1cccc(C(=O)O)c1C.[Hf].
What is the InChIKey of hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid?
The InChIKey is ZFJHPUCCCPXKDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O4.Hf/c1-11-10-13-6-3-4-7-16(13)17(11)23-19(22)15-9-5-8-14(12(15)2)18(20)21;/h3-10,17H,1-2H3,(H,20,21);.
What are the key properties of hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid?
hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid has a molecular weight of 486.82 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium;2-methyl-3-[(2-methyl-1H-inden-1-yl)oxycarbonyl]benzoic acid is sourced from PubChem (CID 174369746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).