C14H19ClN4O2S — CID 174369810
2-[2-(chloromethyl)pyrrol-1-yl]sulfonyl-1-N,3-N,5-N-trimethylbenzene-1,3,5-triamine (PubChem CID 174369810) has the molecular formula C14H19ClN4O2S and a molecular weight of 342.85 g/mol. Its IUPAC name is 2-[2-(chloromethyl)pyrrol-1-yl]sulfonyl-1-N,3-N,5-N-trimethylbenzene-1,3,5-triamine.
| Compound Name | 2-[2-(chloromethyl)pyrrol-1-yl]sulfonyl-1-N,3-N,5-N-trimethylbenzene-1,3,5-triamine |
|---|---|
| PubChem CID | 174369810 |
| Molecular Formula | C14H19ClN4O2S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-[2-(chloromethyl)pyrrol-1-yl]sulfonyl-1-N,3-N,5-N-trimethylbenzene-1,3,5-triamine |
| SMILES | CNc1cc(NC)c(S(=O)(=O)n2cccc2CCl)c(NC)c1 |
| InChI | InChI=1S/C14H19ClN4O2S/c1-16-10-7-12(17-2)14(13(8-10)18-3)22(20,21)19-6-4-5-11(19)9-15/h4-8,16-18H,9H2,1-3H3 |
| InChIKey | NOTDIXYVNBVPMW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|