About prop-2-ene-1,1-diamine;titanium
prop-2-ene-1,1-diamine;titanium (PubChem CID 174369979) has the molecular formula C3H8N2Ti
and a molecular weight of 119.98 g/mol. Its IUPAC name is prop-2-ene-1,1-diamine;titanium.
Molecular Properties
| Compound Name | prop-2-ene-1,1-diamine;titanium |
| PubChem CID | 174369979 |
| Molecular Formula | C3H8N2Ti |
| Molecular Weight | 119.98 g/mol |
| Exact Mass | 120.02 |
| IUPAC Name | prop-2-ene-1,1-diamine;titanium |
| SMILES | C=CC(N)N.[Ti] |
| InChI | InChI=1S/C3H8N2.Ti/c1-2-3(4)5;/h2-3H,1,4-5H2; |
| InChIKey | WCSLVVUPKFHCJK-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.98 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ene-1,1-diamine;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ene-1,1-diamine;titanium?
The IUPAC name of prop-2-ene-1,1-diamine;titanium (CID 174369979) is prop-2-ene-1,1-diamine;titanium.
What is the SMILES notation for prop-2-ene-1,1-diamine;titanium?
The canonical SMILES for prop-2-ene-1,1-diamine;titanium is C=CC(N)N.[Ti].
What is the InChIKey of prop-2-ene-1,1-diamine;titanium?
The InChIKey is WCSLVVUPKFHCJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2.Ti/c1-2-3(4)5;/h2-3H,1,4-5H2;.
What are the key properties of prop-2-ene-1,1-diamine;titanium?
prop-2-ene-1,1-diamine;titanium has a molecular weight of 119.98 g/mol, XLogP of -0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ene-1,1-diamine;titanium is sourced from PubChem (CID 174369979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).