About 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene
6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene (PubChem CID 174370193) has the molecular formula C18H15NO4
and a molecular weight of 309.32 g/mol. Its IUPAC name is 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene.
Molecular Properties
| Compound Name | 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene |
| PubChem CID | 174370193 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene |
| SMILES | COc1ccc2nc(C(=O)O)ccc2c1.c1cc2cc(c1)OC2 |
| InChI | InChI=1S/C11H9NO3.C7H6O/c1-15-8-3-5-9-7(6-8)2-4-10(12-9)11(13)14;1-2-6-4-7(3-1)8-5-6/h2-6H,1H3,(H,13,14);1-4H,5H2 |
| InChIKey | XGWMBCXNVXDCPC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene?
The IUPAC name of 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene (CID 174370193) is 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene.
What is the SMILES notation for 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene?
The canonical SMILES for 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene is COc1ccc2nc(C(=O)O)ccc2c1.c1cc2cc(c1)OC2.
What is the InChIKey of 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene?
The InChIKey is XGWMBCXNVXDCPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3.C7H6O/c1-15-8-3-5-9-7(6-8)2-4-10(12-9)11(13)14;1-2-6-4-7(3-1)8-5-6/h2-6H,1H3,(H,13,14);1-4H,5H2.
What are the key properties of 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene?
6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene has a molecular weight of 309.32 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyquinoline-2-carboxylic acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene is sourced from PubChem (CID 174370193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).