About 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate
4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate (PubChem CID 174370471) has the molecular formula C23H28ClNO6
and a molecular weight of 449.93 g/mol. Its IUPAC name is 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate.
Molecular Properties
| Compound Name | 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate |
| PubChem CID | 174370471 |
| Molecular Formula | C23H28ClNO6 |
| Molecular Weight | 449.93 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate |
| SMILES | Cc1ccc(CC2(O)CCN(CCOC(=O)Cl)CC2)cc1.O=C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H22ClNO3.C7H6O3/c1-13-2-4-14(5-3-13)12-16(20)6-8-18(9-7-16)10-11-21-15(17)19;8-6-3-1-5(2-4-6)7(9)10/h2-5,20H,6-12H2,1H3;1-4,8H,(H,9,10) |
| InChIKey | FDPOKDYDGMUXQB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.93 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate?
The IUPAC name of 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate (CID 174370471) is 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate.
What is the SMILES notation for 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate?
The canonical SMILES for 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate is Cc1ccc(CC2(O)CCN(CCOC(=O)Cl)CC2)cc1.O=C(O)c1ccc(O)cc1.
What is the InChIKey of 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate?
The InChIKey is FDPOKDYDGMUXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22ClNO3.C7H6O3/c1-13-2-4-14(5-3-13)12-16(20)6-8-18(9-7-16)10-11-21-15(17)19;8-6-3-1-5(2-4-6)7(9)10/h2-5,20H,6-12H2,1H3;1-4,8H,(H,9,10).
What are the key properties of 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate?
4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate has a molecular weight of 449.93 g/mol, XLogP of 3.83, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzoic acid;2-[4-hydroxy-4-[(4-methylphenyl)methyl]piperidin-1-yl]ethyl carbonochloridate is sourced from PubChem (CID 174370471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).