C33H40N4O5 — CID 174370790
1-[5-imino-3-methyl-6-oxo-3-pyridin-3-yl-6-(3,4,5-trimethoxyphenyl)hexyl]-4-phenylpiperidine-4-carboxamide (PubChem CID 174370790) has the molecular formula C33H40N4O5 and a molecular weight of 572.71 g/mol. Its IUPAC name is 1-[5-imino-3-methyl-6-oxo-3-pyridin-3-yl-6-(3,4,5-trimethoxyphenyl)hexyl]-4-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[5-imino-3-methyl-6-oxo-3-pyridin-3-yl-6-(3,4,5-trimethoxyphenyl)hexyl]-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 174370790 |
| Molecular Formula | C33H40N4O5 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | 1-[5-imino-3-methyl-6-oxo-3-pyridin-3-yl-6-(3,4,5-trimethoxyphenyl)hexyl]-4-phenylpiperidine-4-carboxamide |
| SMILES | [H]/N=C(/CC(C)(CCN1CCC(C(N)=O)(c2ccccc2)CC1)c1cccnc1)C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C33H40N4O5/c1-32(25-11-8-15-36-22-25,21-26(34)29(38)23-19-27(40-2)30(42-4)28(20-23)41-3)12-16-37-17-13-33(14-18-37,31(35)39)24-9-6-5-7-10-24/h5-11,15,19-20,22,34H,12-14,16-18,21H2,1-4H3,(H2,35,39)/b34-26- |
| InChIKey | SDYLFQPQKBYQJD-CLIDGEQKSA-N |
| XLogP | 4.57 |
| TPSA | 127.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|