About 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine
5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine (PubChem CID 174371179) has the molecular formula C16H15FN4O
and a molecular weight of 298.32 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine |
| PubChem CID | 174371179 |
| Molecular Formula | C16H15FN4O |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine |
| SMILES | C=C/C=C\c1oc(Nc2nc3cc(F)ccc3n2C)nc1C |
| InChI | InChI=1S/C16H15FN4O/c1-4-5-6-14-10(2)18-16(22-14)20-15-19-12-9-11(17)7-8-13(12)21(15)3/h4-9H,1H2,2-3H3,(H,18,19,20)/b6-5- |
| InChIKey | QJMVARTZKXXAJT-WAYWQWQTSA-N |
| XLogP | 3.95 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine?
The IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine (CID 174371179) is 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine.
What is the SMILES notation for 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine?
The canonical SMILES for 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine is C=C/C=C\c1oc(Nc2nc3cc(F)ccc3n2C)nc1C.
What is the InChIKey of 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine?
The InChIKey is QJMVARTZKXXAJT-WAYWQWQTSA-N. The full InChI is InChI=1S/C16H15FN4O/c1-4-5-6-14-10(2)18-16(22-14)20-15-19-12-9-11(17)7-8-13(12)21(15)3/h4-9H,1H2,2-3H3,(H,18,19,20)/b6-5-.
What are the key properties of 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine?
5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine has a molecular weight of 298.32 g/mol, XLogP of 3.95, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1Z)-buta-1,3-dienyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-4-methyl-1,3-oxazol-2-amine is sourced from PubChem (CID 174371179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).