About 4-ethyl-2-methyl-1H-indene;zirconium
4-ethyl-2-methyl-1H-indene;zirconium (PubChem CID 174371242) has the molecular formula C12H14Zr
and a molecular weight of 249.47 g/mol. Its IUPAC name is 4-ethyl-2-methyl-1H-indene;zirconium.
Molecular Properties
| Compound Name | 4-ethyl-2-methyl-1H-indene;zirconium |
| PubChem CID | 174371242 |
| Molecular Formula | C12H14Zr |
| Molecular Weight | 249.47 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 4-ethyl-2-methyl-1H-indene;zirconium |
| SMILES | CCc1cccc2c1C=C(C)C2.[Zr] |
| InChI | InChI=1S/C12H14.Zr/c1-3-10-5-4-6-11-7-9(2)8-12(10)11;/h4-6,8H,3,7H2,1-2H3; |
| InChIKey | CSKOGGZASWMIMU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-ethyl-2-methyl-1H-indene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methyl-1H-indene;zirconium?
The IUPAC name of 4-ethyl-2-methyl-1H-indene;zirconium (CID 174371242) is 4-ethyl-2-methyl-1H-indene;zirconium.
What is the SMILES notation for 4-ethyl-2-methyl-1H-indene;zirconium?
The canonical SMILES for 4-ethyl-2-methyl-1H-indene;zirconium is CCc1cccc2c1C=C(C)C2.[Zr].
What is the InChIKey of 4-ethyl-2-methyl-1H-indene;zirconium?
The InChIKey is CSKOGGZASWMIMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14.Zr/c1-3-10-5-4-6-11-7-9(2)8-12(10)11;/h4-6,8H,3,7H2,1-2H3;.
What are the key properties of 4-ethyl-2-methyl-1H-indene;zirconium?
4-ethyl-2-methyl-1H-indene;zirconium has a molecular weight of 249.47 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methyl-1H-indene;zirconium is sourced from PubChem (CID 174371242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).