C26H29ClN2 — CID 174372380
N'-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenyl]-N,N'-diethylethane-1,2-diamine (PubChem CID 174372380) has the molecular formula C26H29ClN2 and a molecular weight of 404.99 g/mol. Its IUPAC name is N'-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenyl]-N,N'-diethylethane-1,2-diamine.
| Compound Name | N'-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenyl]-N,N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 174372380 |
| Molecular Formula | C26H29ClN2 |
| Molecular Weight | 404.99 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N'-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenyl]-N,N'-diethylethane-1,2-diamine |
| SMILES | CCNCCN(CC)c1ccc(/C(=C(\Cl)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H29ClN2/c1-3-28-19-20-29(4-2)24-17-15-22(16-18-24)25(21-11-7-5-8-12-21)26(27)23-13-9-6-10-14-23/h5-18,28H,3-4,19-20H2,1-2H3/b26-25- |
| InChIKey | FSWDYJVUFFQSLS-QPLCGJKRSA-N |
| XLogP | 6.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.99 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|