About 3,3,3-trifluoropropanamide;trimethylsilane
3,3,3-trifluoropropanamide;trimethylsilane (PubChem CID 174372455) has the molecular formula C6H14F3NOSi
and a molecular weight of 201.26 g/mol. Its IUPAC name is 3,3,3-trifluoropropanamide;trimethylsilane.
Molecular Properties
| Compound Name | 3,3,3-trifluoropropanamide;trimethylsilane |
| PubChem CID | 174372455 |
| Molecular Formula | C6H14F3NOSi |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3,3,3-trifluoropropanamide;trimethylsilane |
| SMILES | C[SiH](C)C.NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C3H4F3NO.C3H10Si/c4-3(5,6)1-2(7)8;1-4(2)3/h1H2,(H2,7,8);4H,1-3H3 |
| InChIKey | XOIDDSLWDPBJCY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,3,3-trifluoropropanamide;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3,3-trifluoropropanamide;trimethylsilane?
The IUPAC name of 3,3,3-trifluoropropanamide;trimethylsilane (CID 174372455) is 3,3,3-trifluoropropanamide;trimethylsilane.
What is the SMILES notation for 3,3,3-trifluoropropanamide;trimethylsilane?
The canonical SMILES for 3,3,3-trifluoropropanamide;trimethylsilane is C[SiH](C)C.NC(=O)CC(F)(F)F.
What is the InChIKey of 3,3,3-trifluoropropanamide;trimethylsilane?
The InChIKey is XOIDDSLWDPBJCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4F3NO.C3H10Si/c4-3(5,6)1-2(7)8;1-4(2)3/h1H2,(H2,7,8);4H,1-3H3.
What are the key properties of 3,3,3-trifluoropropanamide;trimethylsilane?
3,3,3-trifluoropropanamide;trimethylsilane has a molecular weight of 201.26 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,3-trifluoropropanamide;trimethylsilane is sourced from PubChem (CID 174372455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).