C23H30N4O2 — CID 174372855
2-[2-methyl-8-[2,4,6-tris(methylamino)phenyl]quinolin-4-yl]oxybutan-1-ol (PubChem CID 174372855) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[2-methyl-8-[2,4,6-tris(methylamino)phenyl]quinolin-4-yl]oxybutan-1-ol.
| Compound Name | 2-[2-methyl-8-[2,4,6-tris(methylamino)phenyl]quinolin-4-yl]oxybutan-1-ol |
|---|---|
| PubChem CID | 174372855 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2-[2-methyl-8-[2,4,6-tris(methylamino)phenyl]quinolin-4-yl]oxybutan-1-ol |
| SMILES | CCC(CO)Oc1cc(C)nc2c(-c3c(NC)cc(NC)cc3NC)cccc12 |
| InChI | InChI=1S/C23H30N4O2/c1-6-16(13-28)29-21-10-14(2)27-23-17(21)8-7-9-18(23)22-19(25-4)11-15(24-3)12-20(22)26-5/h7-12,16,24-26,28H,6,13H2,1-5H3 |
| InChIKey | RCGXYJAVIITSGL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |