About methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate
methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate (PubChem CID 174373555) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate.
Molecular Properties
| Compound Name | methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate |
| PubChem CID | 174373555 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate |
| SMILES | COC(=O)CC1CCN(C)C1=O.O |
| InChI | InChI=1S/C8H13NO3.H2O/c1-9-4-3-6(8(9)11)5-7(10)12-2;/h6H,3-5H2,1-2H3;1H2 |
| InChIKey | XPLKEKFFWABDIG-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate?
The IUPAC name of methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate (CID 174373555) is methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate.
What is the SMILES notation for methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate?
The canonical SMILES for methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate is COC(=O)CC1CCN(C)C1=O.O.
What is the InChIKey of methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate?
The InChIKey is XPLKEKFFWABDIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3.H2O/c1-9-4-3-6(8(9)11)5-7(10)12-2;/h6H,3-5H2,1-2H3;1H2.
What are the key properties of methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate?
methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate has a molecular weight of 189.21 g/mol, XLogP of -0.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate;hydrate is sourced from PubChem (CID 174373555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).