C20H21N3O4S — CID 17437375
N-[3-[4-[2-[[5-(2-methylfuran-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]phenyl]propyl]acetamide (PubChem CID 17437375) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[3-[4-[2-[[5-(2-methylfuran-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]phenyl]propyl]acetamide.
| Compound Name | N-[3-[4-[2-[[5-(2-methylfuran-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 17437375 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[3-[4-[2-[[5-(2-methylfuran-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]phenyl]propyl]acetamide |
| SMILES | CC(=O)NCCCc1ccc(C(=O)CSc2nnc(-c3ccoc3C)o2)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-13-17(9-11-26-13)19-22-23-20(27-19)28-12-18(25)16-7-5-15(6-8-16)4-3-10-21-14(2)24/h5-9,11H,3-4,10,12H2,1-2H3,(H,21,24) |
| InChIKey | RWOBGKKTBUHZCV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|