About [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid
[4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid (PubChem CID 174373850) has the molecular formula C13H13FO4S
and a molecular weight of 284.31 g/mol. Its IUPAC name is [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid.
Molecular Properties
| Compound Name | [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid |
| PubChem CID | 174373850 |
| Molecular Formula | C13H13FO4S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid |
| SMILES | CC1(C)OC(c2ccc(CS(=O)O)c(F)c2)=CC1=O |
| InChI | InChI=1S/C13H13FO4S/c1-13(2)12(15)6-11(18-13)8-3-4-9(7-19(16)17)10(14)5-8/h3-6H,7H2,1-2H3,(H,16,17) |
| InChIKey | IYSJFKAADVEOIS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid?
The IUPAC name of [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid (CID 174373850) is [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid.
What is the SMILES notation for [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid?
The canonical SMILES for [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid is CC1(C)OC(c2ccc(CS(=O)O)c(F)c2)=CC1=O.
What is the InChIKey of [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid?
The InChIKey is IYSJFKAADVEOIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FO4S/c1-13(2)12(15)6-11(18-13)8-3-4-9(7-19(16)17)10(14)5-8/h3-6H,7H2,1-2H3,(H,16,17).
What are the key properties of [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid?
[4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid has a molecular weight of 284.31 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5,5-dimethyl-4-oxofuran-2-yl)-2-fluorophenyl]methanesulfinic acid is sourced from PubChem (CID 174373850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).