About 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde
7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde (PubChem CID 174373903) has the molecular formula C14H11N3OS
and a molecular weight of 269.33 g/mol. Its IUPAC name is 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde.
Molecular Properties
| Compound Name | 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde |
| PubChem CID | 174373903 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde |
| SMILES | O=CC1N=CNc2cc(Sc3ccncc3)ccc21 |
| InChI | InChI=1S/C14H11N3OS/c18-8-14-12-2-1-11(7-13(12)16-9-17-14)19-10-3-5-15-6-4-10/h1-9,14H,(H,16,17) |
| InChIKey | PJPICEYVMQUHEW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde?
The IUPAC name of 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde (CID 174373903) is 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde.
What is the SMILES notation for 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde?
The canonical SMILES for 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde is O=CC1N=CNc2cc(Sc3ccncc3)ccc21.
What is the InChIKey of 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde?
The InChIKey is PJPICEYVMQUHEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3OS/c18-8-14-12-2-1-11(7-13(12)16-9-17-14)19-10-3-5-15-6-4-10/h1-9,14H,(H,16,17).
What are the key properties of 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde?
7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde has a molecular weight of 269.33 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pyridin-4-ylsulfanyl-1,4-dihydroquinazoline-4-carbaldehyde is sourced from PubChem (CID 174373903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).