About 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea
1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea (PubChem CID 174374661) has the molecular formula C22H28N4O
and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea.
Molecular Properties
| Compound Name | 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea |
| PubChem CID | 174374661 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea |
| SMILES | CCCCCCc1c(C)n(C)c2ccc(N(C(N)=O)c3cccnc3)cc12 |
| InChI | InChI=1S/C22H28N4O/c1-4-5-6-7-10-19-16(2)25(3)21-12-11-17(14-20(19)21)26(22(23)27)18-9-8-13-24-15-18/h8-9,11-15H,4-7,10H2,1-3H3,(H2,23,27) |
| InChIKey | KDOLQAIJZKRSLU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea?
The IUPAC name of 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea (CID 174374661) is 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea.
What is the SMILES notation for 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea?
The canonical SMILES for 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea is CCCCCCc1c(C)n(C)c2ccc(N(C(N)=O)c3cccnc3)cc12.
What is the InChIKey of 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea?
The InChIKey is KDOLQAIJZKRSLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N4O/c1-4-5-6-7-10-19-16(2)25(3)21-12-11-17(14-20(19)21)26(22(23)27)18-9-8-13-24-15-18/h8-9,11-15H,4-7,10H2,1-3H3,(H2,23,27).
What are the key properties of 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea?
1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea has a molecular weight of 364.49 g/mol, XLogP of 5.22, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-hexyl-1,2-dimethylindol-5-yl)-1-pyridin-3-ylurea is sourced from PubChem (CID 174374661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).