About 2-benzyl-1,3-oxazolidine-2-carbaldehyde
2-benzyl-1,3-oxazolidine-2-carbaldehyde (PubChem CID 174374815) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-benzyl-1,3-oxazolidine-2-carbaldehyde.
Molecular Properties
| Compound Name | 2-benzyl-1,3-oxazolidine-2-carbaldehyde |
| PubChem CID | 174374815 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2-benzyl-1,3-oxazolidine-2-carbaldehyde |
| SMILES | O=CC1(Cc2ccccc2)NCCO1 |
| InChI | InChI=1S/C11H13NO2/c13-9-11(12-6-7-14-11)8-10-4-2-1-3-5-10/h1-5,9,12H,6-8H2 |
| InChIKey | BINLNHZBIUGWQX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1,3-oxazolidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1,3-oxazolidine-2-carbaldehyde?
The IUPAC name of 2-benzyl-1,3-oxazolidine-2-carbaldehyde (CID 174374815) is 2-benzyl-1,3-oxazolidine-2-carbaldehyde.
What is the SMILES notation for 2-benzyl-1,3-oxazolidine-2-carbaldehyde?
The canonical SMILES for 2-benzyl-1,3-oxazolidine-2-carbaldehyde is O=CC1(Cc2ccccc2)NCCO1.
What is the InChIKey of 2-benzyl-1,3-oxazolidine-2-carbaldehyde?
The InChIKey is BINLNHZBIUGWQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c13-9-11(12-6-7-14-11)8-10-4-2-1-3-5-10/h1-5,9,12H,6-8H2.
What are the key properties of 2-benzyl-1,3-oxazolidine-2-carbaldehyde?
2-benzyl-1,3-oxazolidine-2-carbaldehyde has a molecular weight of 191.23 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1,3-oxazolidine-2-carbaldehyde is sourced from PubChem (CID 174374815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).