About propylamino 2-phenylethanesulfonate
propylamino 2-phenylethanesulfonate (PubChem CID 174374821) has the molecular formula C11H17NO3S
and a molecular weight of 243.33 g/mol. Its IUPAC name is propylamino 2-phenylethanesulfonate.
Molecular Properties
| Compound Name | propylamino 2-phenylethanesulfonate |
| PubChem CID | 174374821 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | propylamino 2-phenylethanesulfonate |
| SMILES | CCCNOS(=O)(=O)CCc1ccccc1 |
| InChI | InChI=1S/C11H17NO3S/c1-2-9-12-15-16(13,14)10-8-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3 |
| InChIKey | KXAZZWMHGSCKIT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propylamino 2-phenylethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylamino 2-phenylethanesulfonate?
The IUPAC name of propylamino 2-phenylethanesulfonate (CID 174374821) is propylamino 2-phenylethanesulfonate.
What is the SMILES notation for propylamino 2-phenylethanesulfonate?
The canonical SMILES for propylamino 2-phenylethanesulfonate is CCCNOS(=O)(=O)CCc1ccccc1.
What is the InChIKey of propylamino 2-phenylethanesulfonate?
The InChIKey is KXAZZWMHGSCKIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3S/c1-2-9-12-15-16(13,14)10-8-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3.
What are the key properties of propylamino 2-phenylethanesulfonate?
propylamino 2-phenylethanesulfonate has a molecular weight of 243.33 g/mol, XLogP of 1.49, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propylamino 2-phenylethanesulfonate is sourced from PubChem (CID 174374821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).