About 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde
3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde (PubChem CID 174375167) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde |
| PubChem CID | 174375167 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde |
| SMILES | C=C1CC(C)(C)C(CN)=CC1C=O |
| InChI | InChI=1S/C11H17NO/c1-8-5-11(2,3)10(6-12)4-9(8)7-13/h4,7,9H,1,5-6,12H2,2-3H3 |
| InChIKey | ROAJIQAPTJDKLS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde?
The IUPAC name of 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde (CID 174375167) is 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde.
What is the SMILES notation for 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde?
The canonical SMILES for 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde is C=C1CC(C)(C)C(CN)=CC1C=O.
What is the InChIKey of 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde?
The InChIKey is ROAJIQAPTJDKLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-8-5-11(2,3)10(6-12)4-9(8)7-13/h4,7,9H,1,5-6,12H2,2-3H3.
What are the key properties of 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde?
3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde has a molecular weight of 179.26 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde is sourced from PubChem (CID 174375167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).