C16H22N2O6 — CID 174375229
2-amino-4-[amino(phenyl)methoxy]-2-butoxycarbonyl-4-oxobutanoic acid (PubChem CID 174375229) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-amino-4-[amino(phenyl)methoxy]-2-butoxycarbonyl-4-oxobutanoic acid.
| Compound Name | 2-amino-4-[amino(phenyl)methoxy]-2-butoxycarbonyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174375229 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-amino-4-[amino(phenyl)methoxy]-2-butoxycarbonyl-4-oxobutanoic acid |
| SMILES | CCCCOC(=O)C(N)(CC(=O)OC(N)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H22N2O6/c1-2-3-9-23-15(22)16(18,14(20)21)10-12(19)24-13(17)11-7-5-4-6-8-11/h4-8,13H,2-3,9-10,17-18H2,1H3,(H,20,21) |
| InChIKey | WMNFCWJPHWVDIN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|