About 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde
6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde (PubChem CID 174375463) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde |
| PubChem CID | 174375463 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde |
| SMILES | CN(C)C1CC(C)(C)C=CC1C=O |
| InChI | InChI=1S/C11H19NO/c1-11(2)6-5-9(8-13)10(7-11)12(3)4/h5-6,8-10H,7H2,1-4H3 |
| InChIKey | BXBIQXHWNLKRRM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde?
The IUPAC name of 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde (CID 174375463) is 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde.
What is the SMILES notation for 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde?
The canonical SMILES for 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde is CN(C)C1CC(C)(C)C=CC1C=O.
What is the InChIKey of 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde?
The InChIKey is BXBIQXHWNLKRRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-11(2)6-5-9(8-13)10(7-11)12(3)4/h5-6,8-10H,7H2,1-4H3.
What are the key properties of 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde?
6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde has a molecular weight of 181.28 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde is sourced from PubChem (CID 174375463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).