About 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde
5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde (PubChem CID 174375465) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde.
Molecular Properties
| Compound Name | 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde |
| PubChem CID | 174375465 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde |
| SMILES | CCNC1CC(C)(C=O)C=CC1(C)C |
| InChI | InChI=1S/C12H21NO/c1-5-13-10-8-12(4,9-14)7-6-11(10,2)3/h6-7,9-10,13H,5,8H2,1-4H3 |
| InChIKey | PZMPXKOTGWGCRY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde?
The IUPAC name of 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde (CID 174375465) is 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde.
What is the SMILES notation for 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde?
The canonical SMILES for 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde is CCNC1CC(C)(C=O)C=CC1(C)C.
What is the InChIKey of 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde?
The InChIKey is PZMPXKOTGWGCRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-5-13-10-8-12(4,9-14)7-6-11(10,2)3/h6-7,9-10,13H,5,8H2,1-4H3.
What are the key properties of 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde?
5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde has a molecular weight of 195.31 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethylamino)-1,4,4-trimethylcyclohex-2-ene-1-carbaldehyde is sourced from PubChem (CID 174375465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).