C27H24N2 — CID 174375639
2H-1,5-benzodiazepine;2,3,4,5-tetrahydrochrysene (PubChem CID 174375639) has the molecular formula C27H24N2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2H-1,5-benzodiazepine;2,3,4,5-tetrahydrochrysene.
| Compound Name | 2H-1,5-benzodiazepine;2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 174375639 |
| Molecular Formula | C27H24N2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2H-1,5-benzodiazepine;2,3,4,5-tetrahydrochrysene |
| SMILES | C1=CN=c2ccccc2=NC1.C1=c2ccc3c(c2CCC1)CC=c1ccccc1=3 |
| InChI | InChI=1S/C18H16.C9H8N2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-5-9-8(4-1)10-6-3-7-11-9/h1,3,5-7,9-10,12H,2,4,8,11H2;1-6H,7H2 |
| InChIKey | FXWQEBUVKHNFDZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |