About N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride
N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride (PubChem CID 174376861) has the molecular formula C19H19Cl2NO2S
and a molecular weight of 396.34 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride.
Molecular Properties
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride |
| PubChem CID | 174376861 |
| Molecular Formula | C19H19Cl2NO2S |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride |
| SMILES | CCC(=O)Cl.COc1ccc(CNc2cccc3sccc23)cc1Cl |
| InChI | InChI=1S/C16H14ClNOS.C3H5ClO/c1-19-15-6-5-11(9-13(15)17)10-18-14-3-2-4-16-12(14)7-8-20-16;1-2-3(4)5/h2-9,18H,10H2,1H3;2H2,1H3 |
| InChIKey | ILCMESCWAZWDIZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride?
The IUPAC name of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride (CID 174376861) is N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride.
What is the SMILES notation for N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride?
The canonical SMILES for N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride is CCC(=O)Cl.COc1ccc(CNc2cccc3sccc23)cc1Cl.
What is the InChIKey of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride?
The InChIKey is ILCMESCWAZWDIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNOS.C3H5ClO/c1-19-15-6-5-11(9-13(15)17)10-18-14-3-2-4-16-12(14)7-8-20-16;1-2-3(4)5/h2-9,18H,10H2,1H3;2H2,1H3.
What are the key properties of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride?
N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride has a molecular weight of 396.34 g/mol, XLogP of 6.34, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanoyl chloride is sourced from PubChem (CID 174376861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).