About 1,3-dimethylcyclopenta-1,3-diene;zirconium
1,3-dimethylcyclopenta-1,3-diene;zirconium (PubChem CID 174377210) has the molecular formula C7H9Zr-
and a molecular weight of 184.37 g/mol. Its IUPAC name is 1,3-dimethylcyclopenta-1,3-diene;zirconium.
Molecular Properties
| Compound Name | 1,3-dimethylcyclopenta-1,3-diene;zirconium |
| PubChem CID | 174377210 |
| Molecular Formula | C7H9Zr- |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 182.98 |
| IUPAC Name | 1,3-dimethylcyclopenta-1,3-diene;zirconium |
| SMILES | CC1=[C-]CC(C)=C1.[Zr] |
| InChI | InChI=1S/C7H9.Zr/c1-6-3-4-7(2)5-6;/h5H,3H2,1-2H3;/q-1; |
| InChIKey | PAEKHOJRZZCVIM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylcyclopenta-1,3-diene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylcyclopenta-1,3-diene;zirconium?
The IUPAC name of 1,3-dimethylcyclopenta-1,3-diene;zirconium (CID 174377210) is 1,3-dimethylcyclopenta-1,3-diene;zirconium.
What is the SMILES notation for 1,3-dimethylcyclopenta-1,3-diene;zirconium?
The canonical SMILES for 1,3-dimethylcyclopenta-1,3-diene;zirconium is CC1=[C-]CC(C)=C1.[Zr].
What is the InChIKey of 1,3-dimethylcyclopenta-1,3-diene;zirconium?
The InChIKey is PAEKHOJRZZCVIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9.Zr/c1-6-3-4-7(2)5-6;/h5H,3H2,1-2H3;/q-1;.
What are the key properties of 1,3-dimethylcyclopenta-1,3-diene;zirconium?
1,3-dimethylcyclopenta-1,3-diene;zirconium has a molecular weight of 184.37 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylcyclopenta-1,3-diene;zirconium is sourced from PubChem (CID 174377210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).