About alumane;fluoroform
alumane;fluoroform (PubChem CID 174377343) has the molecular formula CH4AlF3
and a molecular weight of 100.02 g/mol. Its IUPAC name is alumane;fluoroform.
Molecular Properties
| Compound Name | alumane;fluoroform |
| PubChem CID | 174377343 |
| Molecular Formula | CH4AlF3 |
| Molecular Weight | 100.02 g/mol |
| Exact Mass | 100.01 |
| IUPAC Name | alumane;fluoroform |
| SMILES | FC(F)F.[AlH3] |
| InChI | InChI=1S/CHF3.Al.3H/c2-1(3)4;;;;/h1H;;;; |
| InChIKey | PPRPSULXLAFCKS-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.02 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze alumane;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;fluoroform?
The IUPAC name of alumane;fluoroform (CID 174377343) is alumane;fluoroform.
What is the SMILES notation for alumane;fluoroform?
The canonical SMILES for alumane;fluoroform is FC(F)F.[AlH3].
What is the InChIKey of alumane;fluoroform?
The InChIKey is PPRPSULXLAFCKS-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3.Al.3H/c2-1(3)4;;;;/h1H;;;;.
What are the key properties of alumane;fluoroform?
alumane;fluoroform has a molecular weight of 100.02 g/mol, XLogP of -0.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;fluoroform is sourced from PubChem (CID 174377343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).