C20H20O2 — CID 174377459
7,8-dimethoxy-2,3,4,5-tetrahydrochrysene (PubChem CID 174377459) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 7,8-dimethoxy-2,3,4,5-tetrahydrochrysene.
| Compound Name | 7,8-dimethoxy-2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 174377459 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 7,8-dimethoxy-2,3,4,5-tetrahydrochrysene |
| SMILES | COc1ccc2c(c1OC)=CCc1c3c(ccc1=2)=CCCC3 |
| InChI | InChI=1S/C20H20O2/c1-21-19-12-11-17-16-8-7-13-5-3-4-6-14(13)15(16)9-10-18(17)20(19)22-2/h5,7-8,10-12H,3-4,6,9H2,1-2H3 |
| InChIKey | IBCWRCHSDLSLFM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |