C18H25NO — CID 174377912
(1R,9R,10R)-6-ethylidene-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3-dien-4-ol (PubChem CID 174377912) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (1R,9R,10R)-6-ethylidene-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3-dien-4-ol.
| Compound Name | (1R,9R,10R)-6-ethylidene-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3-dien-4-ol |
|---|---|
| PubChem CID | 174377912 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (1R,9R,10R)-6-ethylidene-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3-dien-4-ol |
| SMILES | CC=C1CC(O)=CC2=C1C[C@H]1NCC[C@@]23CCCC[C@@H]13 |
| InChI | InChI=1S/C18H25NO/c1-2-12-9-13(20)10-16-14(12)11-17-15-5-3-4-6-18(15,16)7-8-19-17/h2,10,15,17,19-20H,3-9,11H2,1H3/t15-,17+,18+/m0/s1 |
| InChIKey | BNOZKBCHVRWXFO-CGTJXYLNSA-N |
| XLogP | 4.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |